About 2-hydroxybutanedioic acid;prop-2-en-1-ol
2-hydroxybutanedioic acid;prop-2-en-1-ol (PubChem CID 90283079) has the molecular formula C7H12O6
and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;prop-2-en-1-ol.
Molecular Properties
| Compound Name | 2-hydroxybutanedioic acid;prop-2-en-1-ol |
| PubChem CID | 90283079 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-hydroxybutanedioic acid;prop-2-en-1-ol |
| SMILES | C=CCO.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C4H6O5.C3H6O/c5-2(4(8)9)1-3(6)7;1-2-3-4/h2,5H,1H2,(H,6,7)(H,8,9);2,4H,1,3H2 |
| InChIKey | HMCPFTFPVBDLSU-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutanedioic acid;prop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedioic acid;prop-2-en-1-ol?
The IUPAC name of 2-hydroxybutanedioic acid;prop-2-en-1-ol (CID 90283079) is 2-hydroxybutanedioic acid;prop-2-en-1-ol.
What is the SMILES notation for 2-hydroxybutanedioic acid;prop-2-en-1-ol?
The canonical SMILES for 2-hydroxybutanedioic acid;prop-2-en-1-ol is C=CCO.O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-hydroxybutanedioic acid;prop-2-en-1-ol?
The InChIKey is HMCPFTFPVBDLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5.C3H6O/c5-2(4(8)9)1-3(6)7;1-2-3-4/h2,5H,1H2,(H,6,7)(H,8,9);2,4H,1,3H2.
What are the key properties of 2-hydroxybutanedioic acid;prop-2-en-1-ol?
2-hydroxybutanedioic acid;prop-2-en-1-ol has a molecular weight of 192.17 g/mol, XLogP of -0.93, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioic acid;prop-2-en-1-ol is sourced from PubChem (CID 90283079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).