C31H31F3N6O4 — CID 90283226
4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-3-(2-methoxyethoxy)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 90283226) has the molecular formula C31H31F3N6O4 and a molecular weight of 608.62 g/mol. Its IUPAC name is 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-3-(2-methoxyethoxy)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-3-(2-methoxyethoxy)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 90283226 |
| Molecular Formula | C31H31F3N6O4 |
| Molecular Weight | 608.62 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 4-[8-amino-3-[(6R,8aS)-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-6-yl]imidazo[1,5-a]pyrazin-1-yl]-3-(2-methoxyethoxy)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COCCOc1cc(C(=O)Nc2cccc(C(F)(F)F)c2)ccc1-c1nc([C@@H]2CC[C@H]3CCC(=O)N3C2)n2ccnc(N)c12 |
| InChI | InChI=1S/C31H31F3N6O4/c1-43-13-14-44-24-15-18(30(42)37-21-4-2-3-20(16-21)31(32,33)34)6-9-23(24)26-27-28(35)36-11-12-39(27)29(38-26)19-5-7-22-8-10-25(41)40(22)17-19/h2-4,6,9,11-12,15-16,19,22H,5,7-8,10,13-14,17H2,1H3,(H2,35,36)(H,37,42)/t19-,22+/m1/s1 |
| InChIKey | SWPJNJVPWVHTPQ-KNQAVFIVSA-N |
| XLogP | 5.14 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|