C20H23FN4O7 — CID 90283829
(4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-[(E)-hydroxyiminomethyl]-1,3-oxazolidin-2-one (PubChem CID 90283829) has the molecular formula C20H23FN4O7 and a molecular weight of 450.42 g/mol. Its IUPAC name is (4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-[(E)-hydroxyiminomethyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-[(E)-hydroxyiminomethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90283829 |
| Molecular Formula | C20H23FN4O7 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-[(E)-hydroxyiminomethyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1CN(c2c(C3OCCO3)cc3c(N4C(=O)OC[C@@H]4/C=N/O)noc3c2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C20H23FN4O7/c1-10-7-24(8-11(2)31-10)16-13(19-28-3-4-29-19)5-14-17(15(16)21)32-23-18(14)25-12(6-22-27)9-30-20(25)26/h5-6,10-12,19,27H,3-4,7-9H2,1-2H3/b22-6+/t10-,11-,12+/m1/s1 |
| InChIKey | TVWIZPILKGMNCI-DREWLCDZSA-N |
| XLogP | 2.41 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|