C32H44N4O5S2 — CID 90283833
dibenzyl 4-[5-(dithiolan-3-yl)pentanoyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate (PubChem CID 90283833) has the molecular formula C32H44N4O5S2 and a molecular weight of 628.86 g/mol. Its IUPAC name is dibenzyl 4-[5-(dithiolan-3-yl)pentanoyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate.
| Compound Name | dibenzyl 4-[5-(dithiolan-3-yl)pentanoyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 90283833 |
| Molecular Formula | C32H44N4O5S2 |
| Molecular Weight | 628.86 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | dibenzyl 4-[5-(dithiolan-3-yl)pentanoyl]-1,4,7,10-tetrazacyclododecane-1,7-dicarboxylate |
| SMILES | O=C(CCCCC1CCSS1)N1CCN(C(=O)OCc2ccccc2)CCNCCN(C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C32H44N4O5S2/c37-30(14-8-7-13-29-15-24-42-43-29)34-20-22-35(31(38)40-25-27-9-3-1-4-10-27)18-16-33-17-19-36(23-21-34)32(39)41-26-28-11-5-2-6-12-28/h1-6,9-12,29,33H,7-8,13-26H2 |
| InChIKey | HMSAGBBPQZSYFI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|