C23H27N5O3 — CID 90284088
8-[2-(hydroxymethyl)phenyl]-1-methyl-9-[methyl-(3-methylazetidin-3-yl)amino]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 90284088) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 8-[2-(hydroxymethyl)phenyl]-1-methyl-9-[methyl-(3-methylazetidin-3-yl)amino]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | 8-[2-(hydroxymethyl)phenyl]-1-methyl-9-[methyl-(3-methylazetidin-3-yl)amino]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 90284088 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 8-[2-(hydroxymethyl)phenyl]-1-methyl-9-[methyl-(3-methylazetidin-3-yl)amino]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC1C(=O)NN=C2COc3cc(-c4ccccc4CO)c(N(C)C4(C)CNC4)cc3N21 |
| InChI | InChI=1S/C23H27N5O3/c1-14-22(30)26-25-21-11-31-20-8-17(16-7-5-4-6-15(16)10-29)18(9-19(20)28(14)21)27(3)23(2)12-24-13-23/h4-9,14,24,29H,10-13H2,1-3H3,(H,26,30) |
| InChIKey | FSIHGPIDZALGII-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|