C20H24ClN3O6 — CID 90284135
3-[7-chloro-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-1,2-benzoxazol-3-yl]-4-methyl-1,3-oxazolidin-2-one (PubChem CID 90284135) has the molecular formula C20H24ClN3O6 and a molecular weight of 437.88 g/mol. Its IUPAC name is 3-[7-chloro-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-1,2-benzoxazol-3-yl]-4-methyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[7-chloro-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-1,2-benzoxazol-3-yl]-4-methyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90284135 |
| Molecular Formula | C20H24ClN3O6 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 3-[7-chloro-6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-1,2-benzoxazol-3-yl]-4-methyl-1,3-oxazolidin-2-one |
| SMILES | CC1COC(=O)N1c1noc2c(Cl)c(N3C[C@@H](C)O[C@H](C)C3)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C20H24ClN3O6/c1-10-9-28-20(25)24(10)18-14-6-13(19-26-4-5-27-19)16(15(21)17(14)30-22-18)23-7-11(2)29-12(3)8-23/h6,10-12,19H,4-5,7-9H2,1-3H3/t10?,11-,12-/m1/s1 |
| InChIKey | GDIMODKFOKWSFG-PQDIPPBSSA-N |
| XLogP | 3.49 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |