About 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde
5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde (PubChem CID 90284143) has the molecular formula C10H7F3O3
and a molecular weight of 232.16 g/mol. Its IUPAC name is 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde.
Molecular Properties
| Compound Name | 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde |
| PubChem CID | 90284143 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde |
| SMILES | O=Cc1cc(C2OCCO2)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7F3O3/c11-7-5(4-14)3-6(8(12)9(7)13)10-15-1-2-16-10/h3-4,10H,1-2H2 |
| InChIKey | MMZZEDJJKBFZLU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde?
The IUPAC name of 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde (CID 90284143) is 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde.
What is the SMILES notation for 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde?
The canonical SMILES for 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde is O=Cc1cc(C2OCCO2)c(F)c(F)c1F.
What is the InChIKey of 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde?
The InChIKey is MMZZEDJJKBFZLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7F3O3/c11-7-5(4-14)3-6(8(12)9(7)13)10-15-1-2-16-10/h3-4,10H,1-2H2.
What are the key properties of 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde?
5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde has a molecular weight of 232.16 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-dioxolan-2-yl)-2,3,4-trifluorobenzaldehyde is sourced from PubChem (CID 90284143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).