C16H17F4N5O4 — CID 90284146
(1S)-9-(azetidin-3-ylamino)-8-fluoro-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid (PubChem CID 90284146) has the molecular formula C16H17F4N5O4 and a molecular weight of 419.34 g/mol. Its IUPAC name is (1S)-9-(azetidin-3-ylamino)-8-fluoro-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | (1S)-9-(azetidin-3-ylamino)-8-fluoro-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90284146 |
| Molecular Formula | C16H17F4N5O4 |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (1S)-9-(azetidin-3-ylamino)-8-fluoro-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;2,2,2-trifluoroacetic acid |
| SMILES | C[C@H]1C(=O)NN=C2COc3cc(F)c(NC4CNC4)cc3N21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H16FN5O2.C2HF3O2/c1-7-14(21)19-18-13-6-22-12-2-9(15)10(3-11(12)20(7)13)17-8-4-16-5-8;3-2(4,5)1(6)7/h2-3,7-8,16-17H,4-6H2,1H3,(H,19,21);(H,6,7)/t7-;/m0./s1 |
| InChIKey | GOHFEICVGRTUSD-FJXQXJEOSA-N |
| XLogP | 0.87 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|