C22H27F2N3O6 — CID 90284533
(4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(3-fluoropropyl)-1,3-oxazolidin-2-one (PubChem CID 90284533) has the molecular formula C22H27F2N3O6 and a molecular weight of 467.47 g/mol. Its IUPAC name is (4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(3-fluoropropyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(3-fluoropropyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90284533 |
| Molecular Formula | C22H27F2N3O6 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | (4S)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(3-fluoropropyl)-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1CN(c2c(C3OCCO3)cc3c(N4C(=O)OC[C@@H]4CCCF)noc3c2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C22H27F2N3O6/c1-12-9-26(10-13(2)32-12)18-15(21-29-6-7-30-21)8-16-19(17(18)24)33-25-20(16)27-14(4-3-5-23)11-31-22(27)28/h8,12-14,21H,3-7,9-11H2,1-2H3/t12-,13-,14+/m1/s1 |
| InChIKey | OTIYYRVHTUEOJU-MCIONIFRSA-N |
| XLogP | 3.70 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |