C21H26FN3O8S — CID 90284535
(4R)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfonylmethyl)-1,3-oxazolidin-2-one (PubChem CID 90284535) has the molecular formula C21H26FN3O8S and a molecular weight of 499.52 g/mol. Its IUPAC name is (4R)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfonylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfonylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90284535 |
| Molecular Formula | C21H26FN3O8S |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | (4R)-3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfonylmethyl)-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1CN(c2c(C3OCCO3)cc3c(N4C(=O)OC[C@@H]4CS(C)(=O)=O)noc3c2F)C[C@@H](C)O1 |
| InChI | InChI=1S/C21H26FN3O8S/c1-11-7-24(8-12(2)32-11)17-14(20-29-4-5-30-20)6-15-18(16(17)22)33-23-19(15)25-13(9-31-21(25)26)10-34(3,27)28/h6,11-13,20H,4-5,7-10H2,1-3H3/t11-,12-,13-/m1/s1 |
| InChIKey | VTUXJXICZZYIQL-JHJVBQTASA-N |
| XLogP | 2.00 |
| TPSA | 120.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |