C21H26FN3O6S — CID 90284579
3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfanylmethyl)-1,3-oxazolidin-2-one (PubChem CID 90284579) has the molecular formula C21H26FN3O6S and a molecular weight of 467.52 g/mol. Its IUPAC name is 3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfanylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfanylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90284579 |
| Molecular Formula | C21H26FN3O6S |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | 3-[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-5-(1,3-dioxolan-2-yl)-7-fluoro-1,2-benzoxazol-3-yl]-4-(methylsulfanylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CSCC1COC(=O)N1c1noc2c(F)c(N3C[C@@H](C)O[C@H](C)C3)c(C3OCCO3)cc12 |
| InChI | InChI=1S/C21H26FN3O6S/c1-11-7-24(8-12(2)30-11)17-14(20-27-4-5-28-20)6-15-18(16(17)22)31-23-19(15)25-13(10-32-3)9-29-21(25)26/h6,11-13,20H,4-5,7-10H2,1-3H3/t11-,12-,13?/m1/s1 |
| InChIKey | HICSQFFONZVRHJ-ZNRZSNADSA-N |
| XLogP | 3.31 |
| TPSA | 86.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |