C13H8BrF2NO3 — CID 90284883
methyl 3-(4-bromo-2,6-difluorophenoxy)pyridine-2-carboxylate (PubChem CID 90284883) has the molecular formula C13H8BrF2NO3 and a molecular weight of 344.11 g/mol. Its IUPAC name is methyl 3-(4-bromo-2,6-difluorophenoxy)pyridine-2-carboxylate.
| Compound Name | methyl 3-(4-bromo-2,6-difluorophenoxy)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90284883 |
| Molecular Formula | C13H8BrF2NO3 |
| Molecular Weight | 344.11 g/mol |
| Exact Mass | 342.97 |
| IUPAC Name | methyl 3-(4-bromo-2,6-difluorophenoxy)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncccc1Oc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C13H8BrF2NO3/c1-19-13(18)11-10(3-2-4-17-11)20-12-8(15)5-7(14)6-9(12)16/h2-6H,1H3 |
| InChIKey | ZNESKXOFCCKNHQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.11 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |