C28H36N6O4 — CID 90285133
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methyl-N-[[3-(2-methylpyrazol-3-yl)phenyl]methyl]pentanamide (PubChem CID 90285133) has the molecular formula C28H36N6O4 and a molecular weight of 520.63 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methyl-N-[[3-(2-methylpyrazol-3-yl)phenyl]methyl]pentanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methyl-N-[[3-(2-methylpyrazol-3-yl)phenyl]methyl]pentanamide |
|---|---|
| PubChem CID | 90285133 |
| Molecular Formula | C28H36N6O4 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-4-methyl-N-[[3-(2-methylpyrazol-3-yl)phenyl]methyl]pentanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](CC(C)C)C(=O)NCc2cccc(-c3ccnn3C)c2)cc1OC |
| InChI | InChI=1S/C28H36N6O4/c1-18(2)13-22(27(36)30-17-20-7-6-8-21(14-20)23-11-12-31-34(23)3)32-28(29)33-26(35)16-19-9-10-24(37-4)25(15-19)38-5/h6-12,14-15,18,22H,13,16-17H2,1-5H3,(H,30,36)(H3,29,32,33,35)/t22-/m1/s1 |
| InChIKey | MGJHOOMMTHYJKP-JOCHJYFZSA-N |
| XLogP | 2.81 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|