C20H28N2O4 — CID 90285329
1-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-benzyl-3-cyclohexylurea (PubChem CID 90285329) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-benzyl-3-cyclohexylurea.
| Compound Name | 1-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-benzyl-3-cyclohexylurea |
|---|---|
| PubChem CID | 90285329 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(3S,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-benzyl-3-cyclohexylurea |
| SMILES | O=C(NC1CCCCC1)N(Cc1ccccc1)[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C20H28N2O4/c23-17-13-26-18-16(12-25-19(17)18)22(11-14-7-3-1-4-8-14)20(24)21-15-9-5-2-6-10-15/h1,3-4,7-8,15-19,23H,2,5-6,9-13H2,(H,21,24)/t16-,17+,18+,19+/m0/s1 |
| InChIKey | YHCJLNTXAKKGPE-WJFTUGDTSA-N |
| XLogP | 2.06 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |