C23H34N4O4 — CID 90285525
(2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide (PubChem CID 90285525) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 90285525 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)[C@@H](CC1CCCCC1)/N=C(\N)NC(=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H34N4O4/c1-15(2)13-25-22(29)18(10-16-6-4-3-5-7-16)26-23(24)27-21(28)12-17-8-9-19-20(11-17)31-14-30-19/h8-9,11,15-16,18H,3-7,10,12-14H2,1-2H3,(H,25,29)(H3,24,26,27,28)/t18-/m1/s1 |
| InChIKey | VKOSGIAFPGTHQJ-GOSISDBHSA-N |
| XLogP | 2.50 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|