C27H25I2N — CID 90285741
5,11-diiodo-8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene (PubChem CID 90285741) has the molecular formula C27H25I2N and a molecular weight of 617.31 g/mol. Its IUPAC name is 5,11-diiodo-8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene.
| Compound Name | 5,11-diiodo-8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
|---|---|
| PubChem CID | 90285741 |
| Molecular Formula | C27H25I2N |
| Molecular Weight | 617.31 g/mol |
| Exact Mass | 617.01 |
| IUPAC Name | 5,11-diiodo-8,8,14,14,22,22-hexamethyl-1-azahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9,11,13(21),15,17,19-nonaene |
| SMILES | CC1(C)c2cccc3c2N2c4c1cc(I)cc4C(C)(C)c1cc(I)cc(c12)C3(C)C |
| InChI | InChI=1S/C27H25I2N/c1-25(2)16-8-7-9-17-22(16)30-23-18(25)10-14(28)12-20(23)27(5,6)21-13-15(29)11-19(24(21)30)26(17,3)4/h7-13H,1-6H3 |
| InChIKey | NPBHDCZECKKGDT-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.31 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|