C23H34F2N4O3 — CID 90285756
(2R)-2-[[amino-[[2-(2,6-difluoro-4-methoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide (PubChem CID 90285756) has the molecular formula C23H34F2N4O3 and a molecular weight of 452.55 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(2,6-difluoro-4-methoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(2,6-difluoro-4-methoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 90285756 |
| Molecular Formula | C23H34F2N4O3 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.26 |
| IUPAC Name | (2R)-2-[[amino-[[2-(2,6-difluoro-4-methoxyphenyl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-(2-methylpropyl)propanamide |
| SMILES | COc1cc(F)c(CC(=O)N/C(N)=N/[C@H](CC2CCCCC2)C(=O)NCC(C)C)c(F)c1 |
| InChI | InChI=1S/C23H34F2N4O3/c1-14(2)13-27-22(31)20(9-15-7-5-4-6-8-15)28-23(26)29-21(30)12-17-18(24)10-16(32-3)11-19(17)25/h10-11,14-15,20H,4-9,12-13H2,1-3H3,(H,27,31)(H3,26,28,29,30)/t20-/m1/s1 |
| InChIKey | JACXCPVSKAQUCG-HXUWFJFHSA-N |
| XLogP | 3.06 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|