C29H32N4O6 — CID 90285907
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylpropanamide (PubChem CID 90285907) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 90285907 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-[2-(1,3-benzodioxol-5-yl)ethyl]-3-phenylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](Cc2ccccc2)C(=O)NCCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C29H32N4O6/c1-36-23-10-9-21(16-25(23)37-2)17-27(34)33-29(30)32-22(14-19-6-4-3-5-7-19)28(35)31-13-12-20-8-11-24-26(15-20)39-18-38-24/h3-11,15-16,22H,12-14,17-18H2,1-2H3,(H,31,35)(H3,30,32,33,34)/t22-/m1/s1 |
| InChIKey | GERXBCKUMBVTMN-JOCHJYFZSA-N |
| XLogP | 2.38 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|