C27H33FN4O5 — CID 90286018
(2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide (PubChem CID 90286018) has the molecular formula C27H33FN4O5 and a molecular weight of 512.58 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide.
| Compound Name | (2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 90286018 |
| Molecular Formula | C27H33FN4O5 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | (2R)-2-[[amino-[[2-(1,3-benzodioxol-5-yl)acetyl]amino]methylidene]amino]-3-cyclohexyl-N-[(4-fluoro-3-methoxyphenyl)methyl]propanamide |
| SMILES | COc1cc(CNC(=O)[C@@H](CC2CCCCC2)/N=C(\N)NC(=O)Cc2ccc3c(c2)OCO3)ccc1F |
| InChI | InChI=1S/C27H33FN4O5/c1-35-23-13-19(7-9-20(23)28)15-30-26(34)21(11-17-5-3-2-4-6-17)31-27(29)32-25(33)14-18-8-10-22-24(12-18)37-16-36-22/h7-10,12-13,17,21H,2-6,11,14-16H2,1H3,(H,30,34)(H3,29,31,32,33)/t21-/m1/s1 |
| InChIKey | NEIZMGXFFAPQDE-OAQYLSRUSA-N |
| XLogP | 3.19 |
| TPSA | 124.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|