C18H23FN2O5 — CID 90286052
1-[(3S,3aR,6S,6aS)-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(oxan-4-yl)urea (PubChem CID 90286052) has the molecular formula C18H23FN2O5 and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aS)-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(oxan-4-yl)urea.
| Compound Name | 1-[(3S,3aR,6S,6aS)-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(oxan-4-yl)urea |
|---|---|
| PubChem CID | 90286052 |
| Molecular Formula | C18H23FN2O5 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-[(3S,3aR,6S,6aS)-6-(4-fluorophenoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(oxan-4-yl)urea |
| SMILES | O=C(NC1CCOCC1)N[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2Oc1ccc(F)cc1 |
| InChI | InChI=1S/C18H23FN2O5/c19-11-1-3-13(4-2-11)26-15-10-25-16-14(9-24-17(15)16)21-18(22)20-12-5-7-23-8-6-12/h1-4,12,14-17H,5-10H2,(H2,20,21,22)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | OJTYVOQUQWNGEX-MWDXBVQZSA-N |
| XLogP | 1.22 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |