C19H25F2N3O4 — CID 90286065
1-[(3S,3aR,6S,6aS)-6-[(2-methyl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4,4-difluorocyclohexyl)urea (PubChem CID 90286065) has the molecular formula C19H25F2N3O4 and a molecular weight of 397.42 g/mol. Its IUPAC name is 1-[(3S,3aR,6S,6aS)-6-[(2-methyl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4,4-difluorocyclohexyl)urea.
| Compound Name | 1-[(3S,3aR,6S,6aS)-6-[(2-methyl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4,4-difluorocyclohexyl)urea |
|---|---|
| PubChem CID | 90286065 |
| Molecular Formula | C19H25F2N3O4 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-[(3S,3aR,6S,6aS)-6-[(2-methyl-3-pyridinyl)oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(4,4-difluorocyclohexyl)urea |
| SMILES | Cc1ncccc1O[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2NC(=O)NC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H25F2N3O4/c1-11-14(3-2-8-22-11)28-15-10-27-16-13(9-26-17(15)16)24-18(25)23-12-4-6-19(20,21)7-5-12/h2-3,8,12-13,15-17H,4-7,9-10H2,1H3,(H2,23,24,25)/t13-,15-,16+,17+/m0/s1 |
| InChIKey | VPDVRDQRIFNJCR-QMCVQRASSA-N |
| XLogP | 2.18 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |