C17H24Cl2N2O3 — CID 90286070
(3R)-6-[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;dihydrochloride (PubChem CID 90286070) has the molecular formula C17H24Cl2N2O3 and a molecular weight of 375.30 g/mol. Its IUPAC name is (3R)-6-[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;dihydrochloride.
| Compound Name | (3R)-6-[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;dihydrochloride |
|---|---|
| PubChem CID | 90286070 |
| Molecular Formula | C17H24Cl2N2O3 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (3R)-6-[(3S,9aR)-1,3,4,6,7,8,9,9a-octahydropyrazino[2,1-c][1,4]oxazin-3-yl]-3-methyl-3,4-dihydroisochromen-1-one;dihydrochloride |
| SMILES | C[C@@H]1Cc2cc([C@H]3CN4CCNC[C@@H]4CO3)ccc2C(=O)O1.Cl.Cl |
| InChI | InChI=1S/C17H22N2O3.2ClH/c1-11-6-13-7-12(2-3-15(13)17(20)22-11)16-9-19-5-4-18-8-14(19)10-21-16;;/h2-3,7,11,14,16,18H,4-6,8-10H2,1H3;2*1H/t11-,14-,16-;;/m1../s1 |
| InChIKey | YYFQALOGGCLXKQ-KXZGUKMVSA-N |
| XLogP | 1.98 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |