About [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid
[5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid (PubChem CID 90286256) has the molecular formula C5H3F3N2O3
and a molecular weight of 196.08 g/mol. Its IUPAC name is [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid.
Molecular Properties
| Compound Name | [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid |
| PubChem CID | 90286256 |
| Molecular Formula | C5H3F3N2O3 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid |
| SMILES | O=C(O)Nc1ncc(C(F)(F)F)o1 |
| InChI | InChI=1S/C5H3F3N2O3/c6-5(7,8)2-1-9-3(13-2)10-4(11)12/h1H,(H,9,10)(H,11,12) |
| InChIKey | JMWXTRYTLMVXIR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid?
The IUPAC name of [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid (CID 90286256) is [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid.
What is the SMILES notation for [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid?
The canonical SMILES for [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid is O=C(O)Nc1ncc(C(F)(F)F)o1.
What is the InChIKey of [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid?
The InChIKey is JMWXTRYTLMVXIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3N2O3/c6-5(7,8)2-1-9-3(13-2)10-4(11)12/h1H,(H,9,10)(H,11,12).
What are the key properties of [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid?
[5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid has a molecular weight of 196.08 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(trifluoromethyl)-1,3-oxazol-2-yl]carbamic acid is sourced from PubChem (CID 90286256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).