C20H19F3N4O2S — CID 90286694
(3R)-3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-(2,2,2-trifluoroethyl)thiophen-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione (PubChem CID 90286694) has the molecular formula C20H19F3N4O2S and a molecular weight of 436.46 g/mol. Its IUPAC name is (3R)-3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-(2,2,2-trifluoroethyl)thiophen-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione.
| Compound Name | (3R)-3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-(2,2,2-trifluoroethyl)thiophen-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
|---|---|
| PubChem CID | 90286694 |
| Molecular Formula | C20H19F3N4O2S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (3R)-3-methyl-7-(4-methylimidazol-1-yl)-2-[[5-(2,2,2-trifluoroethyl)thiophen-3-yl]methyl]-3,4-dihydropyrido[1,2-a]pyrazine-1,6-dione |
| SMILES | Cc1cn(-c2ccc3n(c2=O)C[C@@H](C)N(Cc2csc(CC(F)(F)F)c2)C3=O)cn1 |
| InChI | InChI=1S/C20H19F3N4O2S/c1-12-7-25(11-24-12)16-3-4-17-19(29)26(13(2)8-27(17)18(16)28)9-14-5-15(30-10-14)6-20(21,22)23/h3-5,7,10-11,13H,6,8-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | IRKUVVWKRSKWEO-CYBMUJFWSA-N |
| XLogP | 3.55 |
| TPSA | 60.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |