About [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate
[5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate (PubChem CID 90286757) has the molecular formula C17H16FN3O4
and a molecular weight of 345.33 g/mol. Its IUPAC name is [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate.
Molecular Properties
| Compound Name | [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate |
| PubChem CID | 90286757 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate |
| SMILES | NC(=O)OCC1=NOC(COc2ccccc2-c2cccnc2F)C1 |
| InChI | InChI=1S/C17H16FN3O4/c18-16-14(5-3-7-20-16)13-4-1-2-6-15(13)23-10-12-8-11(21-25-12)9-24-17(19)22/h1-7,12H,8-10H2,(H2,19,22) |
| InChIKey | UXGPSXJTYOAKBQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate?
The IUPAC name of [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate (CID 90286757) is [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate.
What is the SMILES notation for [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate?
The canonical SMILES for [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate is NC(=O)OCC1=NOC(COc2ccccc2-c2cccnc2F)C1.
What is the InChIKey of [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate?
The InChIKey is UXGPSXJTYOAKBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O4/c18-16-14(5-3-7-20-16)13-4-1-2-6-15(13)23-10-12-8-11(21-25-12)9-24-17(19)22/h1-7,12H,8-10H2,(H2,19,22).
What are the key properties of [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate?
[5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate has a molecular weight of 345.33 g/mol, XLogP of 2.51, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[[2-(2-fluoro-3-pyridinyl)phenoxy]methyl]-4,5-dihydro-1,2-oxazol-3-yl]methyl carbamate is sourced from PubChem (CID 90286757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).