About 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde
5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde (PubChem CID 90286803) has the molecular formula C10H9ClF2N2O
and a molecular weight of 246.64 g/mol. Its IUPAC name is 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde |
| PubChem CID | 90286803 |
| Molecular Formula | C10H9ClF2N2O |
| Molecular Weight | 246.64 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde |
| SMILES | C=CCn1nc(C(F)(F)C=C)c(C=O)c1Cl |
| InChI | InChI=1S/C10H9ClF2N2O/c1-3-5-15-9(11)7(6-16)8(14-15)10(12,13)4-2/h3-4,6H,1-2,5H2 |
| InChIKey | KTCRNXDHETWCBV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde?
The IUPAC name of 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde (CID 90286803) is 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde.
What is the SMILES notation for 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde?
The canonical SMILES for 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde is C=CCn1nc(C(F)(F)C=C)c(C=O)c1Cl.
What is the InChIKey of 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde?
The InChIKey is KTCRNXDHETWCBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2N2O/c1-3-5-15-9(11)7(6-16)8(14-15)10(12,13)4-2/h3-4,6H,1-2,5H2.
What are the key properties of 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde?
5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde has a molecular weight of 246.64 g/mol, XLogP of 2.81, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-(1,1-difluoroprop-2-enyl)-1-prop-2-enylpyrazole-4-carbaldehyde is sourced from PubChem (CID 90286803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).