About N-(4-fluorophenyl)-2,6-dimethoxyaniline
N-(4-fluorophenyl)-2,6-dimethoxyaniline (PubChem CID 90287049) has the molecular formula C14H14FNO2
and a molecular weight of 247.27 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2,6-dimethoxyaniline.
Molecular Properties
| Compound Name | N-(4-fluorophenyl)-2,6-dimethoxyaniline |
| PubChem CID | 90287049 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(4-fluorophenyl)-2,6-dimethoxyaniline |
| SMILES | COc1cccc(OC)c1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO2/c1-17-12-4-3-5-13(18-2)14(12)16-11-8-6-10(15)7-9-11/h3-9,16H,1-2H3 |
| InChIKey | MJLSWDMORXPQMV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-fluorophenyl)-2,6-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-fluorophenyl)-2,6-dimethoxyaniline?
The IUPAC name of N-(4-fluorophenyl)-2,6-dimethoxyaniline (CID 90287049) is N-(4-fluorophenyl)-2,6-dimethoxyaniline.
What is the SMILES notation for N-(4-fluorophenyl)-2,6-dimethoxyaniline?
The canonical SMILES for N-(4-fluorophenyl)-2,6-dimethoxyaniline is COc1cccc(OC)c1Nc1ccc(F)cc1.
What is the InChIKey of N-(4-fluorophenyl)-2,6-dimethoxyaniline?
The InChIKey is MJLSWDMORXPQMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO2/c1-17-12-4-3-5-13(18-2)14(12)16-11-8-6-10(15)7-9-11/h3-9,16H,1-2H3.
What are the key properties of N-(4-fluorophenyl)-2,6-dimethoxyaniline?
N-(4-fluorophenyl)-2,6-dimethoxyaniline has a molecular weight of 247.27 g/mol, XLogP of 3.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-fluorophenyl)-2,6-dimethoxyaniline is sourced from PubChem (CID 90287049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).