C24H30N2O7S — CID 90287245
diethyl 2-[(2,4-dimethoxyphenyl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3,7-dicarboxylate (PubChem CID 90287245) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is diethyl 2-[(2,4-dimethoxyphenyl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3,7-dicarboxylate.
| Compound Name | diethyl 2-[(2,4-dimethoxyphenyl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3,7-dicarboxylate |
|---|---|
| PubChem CID | 90287245 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | diethyl 2-[(2,4-dimethoxyphenyl)methylcarbamoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3,7-dicarboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)NCc2ccc(OC)cc2OC)sc2c1CCCC2C(=O)OCC |
| InChI | InChI=1S/C24H30N2O7S/c1-5-32-22(27)17-9-7-8-16-19(23(28)33-6-2)21(34-20(16)17)26-24(29)25-13-14-10-11-15(30-3)12-18(14)31-4/h10-12,17H,5-9,13H2,1-4H3,(H2,25,26,29) |
| InChIKey | OQDALWJYHVDLCW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |