C20H18F3N3OS — CID 90287440
N,N-dimethyl-3-[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazin-3-yl]oxypropan-1-amine (PubChem CID 90287440) has the molecular formula C20H18F3N3OS and a molecular weight of 405.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazin-3-yl]oxypropan-1-amine.
| Compound Name | N,N-dimethyl-3-[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazin-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 90287440 |
| Molecular Formula | C20H18F3N3OS |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N,N-dimethyl-3-[2-[2-[4-(trifluoromethyl)phenyl]ethynyl]thieno[3,4-b]pyrazin-3-yl]oxypropan-1-amine |
| SMILES | CN(C)CCCOc1nc2cscc2nc1C#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18F3N3OS/c1-26(2)10-3-11-27-19-16(24-17-12-28-13-18(17)25-19)9-6-14-4-7-15(8-5-14)20(21,22)23/h4-5,7-8,12-13H,3,10-11H2,1-2H3 |
| InChIKey | DJIGAOPXFJHBHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|