About CID 90287656
CID 90287656 (PubChem CID 90287656) has the molecular formula C23H28N2O2
and a molecular weight of 364.49 g/mol.
Molecular Properties
| Compound Name | CID 90287656 |
| PubChem CID | 90287656 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | — |
| SMILES | COC1CCC2(CC1)Cc1ccc(C#CC3CC3)cc1C21C=C(N)N(C)O1 |
| InChI | InChI=1S/C23H28N2O2/c1-25-21(24)15-23(27-25)20-13-17(6-5-16-3-4-16)7-8-18(20)14-22(23)11-9-19(26-2)10-12-22/h7-8,13,15-16,19H,3-4,9-12,14,24H2,1-2H3 |
| InChIKey | ZDSBZIIUGHFAOZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 90287656 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90287656?
The IUPAC name of CID 90287656 (CID 90287656) is not available.
What is the SMILES notation for CID 90287656?
The canonical SMILES for CID 90287656 is COC1CCC2(CC1)Cc1ccc(C#CC3CC3)cc1C21C=C(N)N(C)O1.
What is the InChIKey of CID 90287656?
The InChIKey is ZDSBZIIUGHFAOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O2/c1-25-21(24)15-23(27-25)20-13-17(6-5-16-3-4-16)7-8-18(20)14-22(23)11-9-19(26-2)10-12-22/h7-8,13,15-16,19H,3-4,9-12,14,24H2,1-2H3.
What are the key properties of CID 90287656?
CID 90287656 has a molecular weight of 364.49 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90287656 is sourced from PubChem (CID 90287656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).