C15H15N5S — CID 90287811
5-cyclopentyl-N-(1,5-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90287811) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 5-cyclopentyl-N-(1,5-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopentyl-N-(1,5-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90287811 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 5-cyclopentyl-N-(1,5-naphthyridin-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | c1cnc2ccc(Nc3nnc(C4CCCC4)s3)nc2c1 |
| InChI | InChI=1S/C15H15N5S/c1-2-5-10(4-1)14-19-20-15(21-14)18-13-8-7-11-12(17-13)6-3-9-16-11/h3,6-10H,1-2,4-5H2,(H,17,18,20) |
| InChIKey | PZWOWNXDCAVQQQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |