C31H42N8OSSi — CID 90287836
2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(5-piperidin-1-yl-3-pyridinyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine (PubChem CID 90287836) has the molecular formula C31H42N8OSSi and a molecular weight of 602.89 g/mol. Its IUPAC name is 2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(5-piperidin-1-yl-3-pyridinyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine.
| Compound Name | 2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(5-piperidin-1-yl-3-pyridinyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine |
|---|---|
| PubChem CID | 90287836 |
| Molecular Formula | C31H42N8OSSi |
| Molecular Weight | 602.89 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(5-piperidin-1-yl-3-pyridinyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine |
| SMILES | C[Si](C)(C)CCOCN(c1ccc2ncc(Nc3cncc(N4CCCCC4)c3)cc2n1)c1nnc(C2CCCC2)s1 |
| InChI | InChI=1S/C31H42N8OSSi/c1-42(2,3)16-15-40-22-39(31-37-36-30(41-31)23-9-5-6-10-23)29-12-11-27-28(35-29)18-25(20-33-27)34-24-17-26(21-32-19-24)38-13-7-4-8-14-38/h11-12,17-21,23,34H,4-10,13-16,22H2,1-3H3 |
| InChIKey | AVVPAXAKQVMRID-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 92.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.89 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|