C21H28BrN5OSSi — CID 90287921
N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine (PubChem CID 90287921) has the molecular formula C21H28BrN5OSSi and a molecular weight of 506.55 g/mol. Its IUPAC name is N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine.
| Compound Name | N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 90287921 |
| Molecular Formula | C21H28BrN5OSSi |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine |
| SMILES | C[Si](C)(C)CCOCn1nc(C2CCCC2)s/c1=N\c1ccc2ncc(Br)cc2n1 |
| InChI | InChI=1S/C21H28BrN5OSSi/c1-30(2,3)11-10-28-14-27-21(29-20(26-27)15-6-4-5-7-15)25-19-9-8-17-18(24-19)12-16(22)13-23-17/h8-9,12-13,15H,4-7,10-11,14H2,1-3H3/b25-21- |
| InChIKey | IPFAJMGBYFVVJB-DAFNUICNSA-N |
| XLogP | 5.85 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|