C25H34N8O3SSi — CID 90288041
tert-butyl 4-[[6-[(5-methyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate (PubChem CID 90288041) has the molecular formula C25H34N8O3SSi and a molecular weight of 554.75 g/mol. Its IUPAC name is tert-butyl 4-[[6-[(5-methyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate.
| Compound Name | tert-butyl 4-[[6-[(5-methyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 90288041 |
| Molecular Formula | C25H34N8O3SSi |
| Molecular Weight | 554.75 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | tert-butyl 4-[[6-[(5-methyl-1,3,4-thiadiazol-2-yl)-(2-trimethylsilylethoxymethyl)amino]-1,5-naphthyridin-3-yl]amino]pyrazole-1-carboxylate |
| SMILES | Cc1nnc(N(COCC[Si](C)(C)C)c2ccc3ncc(Nc4cnn(C(=O)OC(C)(C)C)c4)cc3n2)s1 |
| InChI | InChI=1S/C25H34N8O3SSi/c1-17-30-31-23(37-17)32(16-35-10-11-38(5,6)7)22-9-8-20-21(29-22)12-18(13-26-20)28-19-14-27-33(15-19)24(34)36-25(2,3)4/h8-9,12-15,28H,10-11,16H2,1-7H3 |
| InChIKey | KLZSCZVGBBQZRI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 120.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.75 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|