C24H36N6O2SSi — CID 90288150
2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(2-methoxyethyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine (PubChem CID 90288150) has the molecular formula C24H36N6O2SSi and a molecular weight of 500.75 g/mol. Its IUPAC name is 2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(2-methoxyethyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine.
| Compound Name | 2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(2-methoxyethyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine |
|---|---|
| PubChem CID | 90288150 |
| Molecular Formula | C24H36N6O2SSi |
| Molecular Weight | 500.75 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 2-N-(5-cyclopentyl-1,3,4-thiadiazol-2-yl)-7-N-(2-methoxyethyl)-2-N-(2-trimethylsilylethoxymethyl)-1,5-naphthyridine-2,7-diamine |
| SMILES | COCCNc1cnc2ccc(N(COCC[Si](C)(C)C)c3nnc(C4CCCC4)s3)nc2c1 |
| InChI | InChI=1S/C24H36N6O2SSi/c1-31-12-11-25-19-15-21-20(26-16-19)9-10-22(27-21)30(17-32-13-14-34(2,3)4)24-29-28-23(33-24)18-7-5-6-8-18/h9-10,15-16,18,25H,5-8,11-14,17H2,1-4H3 |
| InChIKey | XYSQCCMENHQUHN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|