C22H32BrN5OSSi — CID 90288162
N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-methyl-N-(2-trimethylsilylethoxymethyl)-2H-1,3,4-thiadiazol-2-amine (PubChem CID 90288162) has the molecular formula C22H32BrN5OSSi and a molecular weight of 522.59 g/mol. Its IUPAC name is N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-methyl-N-(2-trimethylsilylethoxymethyl)-2H-1,3,4-thiadiazol-2-amine.
| Compound Name | N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-methyl-N-(2-trimethylsilylethoxymethyl)-2H-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90288162 |
| Molecular Formula | C22H32BrN5OSSi |
| Molecular Weight | 522.59 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | N-(7-bromo-1,5-naphthyridin-2-yl)-5-cyclopentyl-3-methyl-N-(2-trimethylsilylethoxymethyl)-2H-1,3,4-thiadiazol-2-amine |
| SMILES | CN1N=C(C2CCCC2)SC1N(COCC[Si](C)(C)C)c1ccc2ncc(Br)cc2n1 |
| InChI | InChI=1S/C22H32BrN5OSSi/c1-27-22(30-21(26-27)16-7-5-6-8-16)28(15-29-11-12-31(2,3)4)20-10-9-18-19(25-20)13-17(23)14-24-18/h9-10,13-14,16,22H,5-8,11-12,15H2,1-4H3 |
| InChIKey | SSCDNSHJMKFPDM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.59 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|