C19H21N7S — CID 90288215
N-[7-[(Z)-3-amino-1-iminobut-2-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine (PubChem CID 90288215) has the molecular formula C19H21N7S and a molecular weight of 379.49 g/mol. Its IUPAC name is N-[7-[(Z)-3-amino-1-iminobut-2-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine.
| Compound Name | N-[7-[(Z)-3-amino-1-iminobut-2-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90288215 |
| Molecular Formula | C19H21N7S |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[7-[(Z)-3-amino-1-iminobut-2-en-2-yl]-1,5-naphthyridin-2-yl]-5-cyclopentyl-1,3,4-thiadiazol-2-amine |
| SMILES | [H]/N=C/C(=C(/C)N)c1cnc2ccc(Nc3nnc(C4CCCC4)s3)nc2c1 |
| InChI | InChI=1S/C19H21N7S/c1-11(21)14(9-20)13-8-16-15(22-10-13)6-7-17(23-16)24-19-26-25-18(27-19)12-4-2-3-5-12/h6-10,12,20H,2-5,21H2,1H3,(H,23,24,26)/b14-11+,20-9+ |
| InChIKey | YWYLHJONECSNCL-UQXWRELISA-N |
| XLogP | 4.22 |
| TPSA | 113.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|