About [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea
[7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea (PubChem CID 90288240) has the molecular formula C18H21N7O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea.
Molecular Properties
| Compound Name | [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea |
| PubChem CID | 90288240 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea |
| SMILES | NC(=O)Nc1ccc2ncc(-c3cnn(CCN4CCOCC4)c3)cc2n1 |
| InChI | InChI=1S/C18H21N7O2/c19-18(26)23-17-2-1-15-16(22-17)9-13(10-20-15)14-11-21-25(12-14)4-3-24-5-7-27-8-6-24/h1-2,9-12H,3-8H2,(H3,19,22,23,26) |
| InChIKey | IZWMJPYGIQDUOY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 111.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea?
The IUPAC name of [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea (CID 90288240) is [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea.
What is the SMILES notation for [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea?
The canonical SMILES for [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea is NC(=O)Nc1ccc2ncc(-c3cnn(CCN4CCOCC4)c3)cc2n1.
What is the InChIKey of [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea?
The InChIKey is IZWMJPYGIQDUOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N7O2/c19-18(26)23-17-2-1-15-16(22-17)9-13(10-20-15)14-11-21-25(12-14)4-3-24-5-7-27-8-6-24/h1-2,9-12H,3-8H2,(H3,19,22,23,26).
What are the key properties of [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea?
[7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea has a molecular weight of 367.41 g/mol, XLogP of 1.32, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7-[1-(2-morpholin-4-ylethyl)pyrazol-4-yl]-1,5-naphthyridin-2-yl]urea is sourced from PubChem (CID 90288240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).