C26H31F3N8S — CID 90288248
5-cyclopentyl-N-[7-[2-methyl-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3H-pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine (PubChem CID 90288248) has the molecular formula C26H31F3N8S and a molecular weight of 544.65 g/mol. Its IUPAC name is 5-cyclopentyl-N-[7-[2-methyl-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3H-pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-cyclopentyl-N-[7-[2-methyl-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3H-pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90288248 |
| Molecular Formula | C26H31F3N8S |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 5-cyclopentyl-N-[7-[2-methyl-1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]-3H-pyrazol-4-yl]-1,5-naphthyridin-2-yl]-1,3,4-thiadiazol-2-amine |
| SMILES | CN1CC(c2cnc3ccc(Nc4nnc(C5CCCC5)s4)nc3c2)=CN1C1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C26H31F3N8S/c1-35-14-19(15-37(35)20-8-10-36(11-9-20)16-26(27,28)29)18-12-22-21(30-13-18)6-7-23(31-22)32-25-34-33-24(38-25)17-4-2-3-5-17/h6-7,12-13,15,17,20H,2-5,8-11,14,16H2,1H3,(H,31,32,34) |
| InChIKey | ODQDUVFOUBQJKH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |