About 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine
4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine (PubChem CID 90288277) has the molecular formula C19H22ClN5O
and a molecular weight of 371.87 g/mol. Its IUPAC name is 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine.
Molecular Properties
| Compound Name | 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine |
| PubChem CID | 90288277 |
| Molecular Formula | C19H22ClN5O |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine |
| SMILES | Cc1nn(CCCN2CCOCC2)cc1-c1cnc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C19H22ClN5O/c1-14-16(15-11-18-17(21-12-15)3-4-19(20)22-18)13-25(23-14)6-2-5-24-7-9-26-10-8-24/h3-4,11-13H,2,5-10H2,1H3 |
| InChIKey | ZGJHGZHKPRDCDD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine?
The IUPAC name of 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine (CID 90288277) is 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine.
What is the SMILES notation for 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine?
The canonical SMILES for 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine is Cc1nn(CCCN2CCOCC2)cc1-c1cnc2ccc(Cl)nc2c1.
What is the InChIKey of 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine?
The InChIKey is ZGJHGZHKPRDCDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClN5O/c1-14-16(15-11-18-17(21-12-15)3-4-19(20)22-18)13-25(23-14)6-2-5-24-7-9-26-10-8-24/h3-4,11-13H,2,5-10H2,1H3.
What are the key properties of 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine?
4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine has a molecular weight of 371.87 g/mol, XLogP of 3.18, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]morpholine is sourced from PubChem (CID 90288277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).