C19H22ClN5 — CID 90288353
2-chloro-7-[3-methyl-1-(3-pyrrolidin-1-ylpropyl)pyrazol-4-yl]-1,5-naphthyridine (PubChem CID 90288353) has the molecular formula C19H22ClN5 and a molecular weight of 355.87 g/mol. Its IUPAC name is 2-chloro-7-[3-methyl-1-(3-pyrrolidin-1-ylpropyl)pyrazol-4-yl]-1,5-naphthyridine.
| Compound Name | 2-chloro-7-[3-methyl-1-(3-pyrrolidin-1-ylpropyl)pyrazol-4-yl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 90288353 |
| Molecular Formula | C19H22ClN5 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-chloro-7-[3-methyl-1-(3-pyrrolidin-1-ylpropyl)pyrazol-4-yl]-1,5-naphthyridine |
| SMILES | Cc1nn(CCCN2CCCC2)cc1-c1cnc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C19H22ClN5/c1-14-16(13-25(23-14)10-4-9-24-7-2-3-8-24)15-11-18-17(21-12-15)5-6-19(20)22-18/h5-6,11-13H,2-4,7-10H2,1H3 |
| InChIKey | VNFKZUKSOHDOER-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|