C31H41F3N8OSSi — CID 90288413
5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine (PubChem CID 90288413) has the molecular formula C31H41F3N8OSSi and a molecular weight of 658.87 g/mol. Its IUPAC name is 5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine.
| Compound Name | 5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine |
|---|---|
| PubChem CID | 90288413 |
| Molecular Formula | C31H41F3N8OSSi |
| Molecular Weight | 658.87 g/mol |
| Exact Mass | 658.28 |
| IUPAC Name | 5-cyclopentyl-N-[7-[1-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]pyrazol-4-yl]-1,5-naphthyridin-2-yl]-3-(2-trimethylsilylethoxymethyl)-1,3,4-thiadiazol-2-imine |
| SMILES | C[Si](C)(C)CCOCn1nc(C2CCCC2)s/c1=N/c1ccc2ncc(-c3cnn(C4CCN(CC(F)(F)F)CC4)c3)cc2n1 |
| InChI | InChI=1S/C31H41F3N8OSSi/c1-45(2,3)15-14-43-21-42-30(44-29(39-42)22-6-4-5-7-22)38-28-9-8-26-27(37-28)16-23(17-35-26)24-18-36-41(19-24)25-10-12-40(13-11-25)20-31(32,33)34/h8-9,16-19,22,25H,4-7,10-15,20-21H2,1-3H3/b38-30+ |
| InChIKey | GGRUQXVIQZPBHM-BIXQXLNPSA-N |
| XLogP | 7.15 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.87 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|