C21H26ClN5O — CID 90288481
(2R,6S)-4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]-2,6-dimethylmorpholine (PubChem CID 90288481) has the molecular formula C21H26ClN5O and a molecular weight of 399.93 g/mol. Its IUPAC name is (2R,6S)-4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 90288481 |
| Molecular Formula | C21H26ClN5O |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | (2R,6S)-4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)-3-methylpyrazol-1-yl]propyl]-2,6-dimethylmorpholine |
| SMILES | Cc1nn(CCCN2C[C@@H](C)O[C@@H](C)C2)cc1-c1cnc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C21H26ClN5O/c1-14-11-26(12-15(2)28-14)7-4-8-27-13-18(16(3)25-27)17-9-20-19(23-10-17)5-6-21(22)24-20/h5-6,9-10,13-15H,4,7-8,11-12H2,1-3H3/t14-,15+ |
| InChIKey | SUDLUXRADXTXSY-GASCZTMLSA-N |
| XLogP | 3.95 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|