C15H12ClF3N4O — CID 90288586
4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-1,1,1-trifluorobutan-2-ol (PubChem CID 90288586) has the molecular formula C15H12ClF3N4O and a molecular weight of 356.74 g/mol. Its IUPAC name is 4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-1,1,1-trifluorobutan-2-ol.
| Compound Name | 4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 90288586 |
| Molecular Formula | C15H12ClF3N4O |
| Molecular Weight | 356.74 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-1,1,1-trifluorobutan-2-ol |
| SMILES | OC(CCn1cc(-c2cnc3ccc(Cl)nc3c2)cn1)C(F)(F)F |
| InChI | InChI=1S/C15H12ClF3N4O/c16-14-2-1-11-12(22-14)5-9(6-20-11)10-7-21-23(8-10)4-3-13(24)15(17,18)19/h1-2,5-8,13,24H,3-4H2 |
| InChIKey | UBGBCNQHLXEEOH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|