C13H8ClF3N4 — CID 90288598
2-chloro-7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,5-naphthyridine (PubChem CID 90288598) has the molecular formula C13H8ClF3N4 and a molecular weight of 312.68 g/mol. Its IUPAC name is 2-chloro-7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,5-naphthyridine.
| Compound Name | 2-chloro-7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 90288598 |
| Molecular Formula | C13H8ClF3N4 |
| Molecular Weight | 312.68 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 2-chloro-7-[1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-1,5-naphthyridine |
| SMILES | FC(F)(F)Cn1cc(-c2cnc3ccc(Cl)nc3c2)cn1 |
| InChI | InChI=1S/C13H8ClF3N4/c14-12-2-1-10-11(20-12)3-8(4-18-10)9-5-19-21(6-9)7-13(15,16)17/h1-6H,7H2 |
| InChIKey | QBSVHMSFVXISDY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|