About (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine
(Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine (PubChem CID 90288781) has the molecular formula C11H11ClN4
and a molecular weight of 234.69 g/mol. Its IUPAC name is (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine.
Molecular Properties
| Compound Name | (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine |
| PubChem CID | 90288781 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine |
| SMILES | N/C=C(\CN)c1cnc2ccc(Cl)nc2c1 |
| InChI | InChI=1S/C11H11ClN4/c12-11-2-1-9-10(16-11)3-7(6-15-9)8(4-13)5-14/h1-4,6H,5,13-14H2/b8-4+ |
| InChIKey | WJECCXKVTBLHET-XBXARRHUSA-N |
| XLogP | 1.54 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine?
The IUPAC name of (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine (CID 90288781) is (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine.
What is the SMILES notation for (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine?
The canonical SMILES for (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine is N/C=C(\CN)c1cnc2ccc(Cl)nc2c1.
What is the InChIKey of (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine?
The InChIKey is WJECCXKVTBLHET-XBXARRHUSA-N. The full InChI is InChI=1S/C11H11ClN4/c12-11-2-1-9-10(16-11)3-7(6-15-9)8(4-13)5-14/h1-4,6H,5,13-14H2/b8-4+.
What are the key properties of (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine?
(Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine has a molecular weight of 234.69 g/mol, XLogP of 1.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(6-chloro-1,5-naphthyridin-3-yl)prop-1-ene-1,3-diamine is sourced from PubChem (CID 90288781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).