About 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol
2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol (PubChem CID 90288794) has the molecular formula C16H18ClN5O
and a molecular weight of 331.81 g/mol. Its IUPAC name is 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol.
Molecular Properties
| Compound Name | 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol |
| PubChem CID | 90288794 |
| Molecular Formula | C16H18ClN5O |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol |
| SMILES | OCCNCCCn1cc(-c2cnc3ccc(Cl)nc3c2)cn1 |
| InChI | InChI=1S/C16H18ClN5O/c17-16-3-2-14-15(21-16)8-12(9-19-14)13-10-20-22(11-13)6-1-4-18-5-7-23/h2-3,8-11,18,23H,1,4-7H2 |
| InChIKey | YVVSSMBATGWPDD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol?
The IUPAC name of 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol (CID 90288794) is 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol.
What is the SMILES notation for 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol?
The canonical SMILES for 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol is OCCNCCCn1cc(-c2cnc3ccc(Cl)nc3c2)cn1.
What is the InChIKey of 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol?
The InChIKey is YVVSSMBATGWPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN5O/c17-16-3-2-14-15(21-16)8-12(9-19-14)13-10-20-22(11-13)6-1-4-18-5-7-23/h2-3,8-11,18,23H,1,4-7H2.
What are the key properties of 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol?
2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol has a molecular weight of 331.81 g/mol, XLogP of 2.12, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propylamino]ethanol is sourced from PubChem (CID 90288794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).