About 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine
4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine (PubChem CID 90288795) has the molecular formula C21H25ClN6O
and a molecular weight of 412.93 g/mol. Its IUPAC name is 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine.
Molecular Properties
| Compound Name | 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine |
| PubChem CID | 90288795 |
| Molecular Formula | C21H25ClN6O |
| Molecular Weight | 412.93 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine |
| SMILES | Clc1ccc2ncc(-c3cnn(CC4CCN(N5CCOCC5)CC4)c3)cc2n1 |
| InChI | InChI=1S/C21H25ClN6O/c22-21-2-1-19-20(25-21)11-17(12-23-19)18-13-24-26(15-18)14-16-3-5-27(6-4-16)28-7-9-29-10-8-28/h1-2,11-13,15-16H,3-10,14H2 |
| InChIKey | ZZLQLEIJVUXRTA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.93 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine?
The IUPAC name of 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine (CID 90288795) is 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine.
What is the SMILES notation for 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine?
The canonical SMILES for 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine is Clc1ccc2ncc(-c3cnn(CC4CCN(N5CCOCC5)CC4)c3)cc2n1.
What is the InChIKey of 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine?
The InChIKey is ZZLQLEIJVUXRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClN6O/c22-21-2-1-19-20(25-21)11-17(12-23-19)18-13-24-26(15-18)14-16-3-5-27(6-4-16)28-7-9-29-10-8-28/h1-2,11-13,15-16H,3-10,14H2.
What are the key properties of 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine?
4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine has a molecular weight of 412.93 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]methyl]piperidin-1-yl]morpholine is sourced from PubChem (CID 90288795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).