About 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol
2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol (PubChem CID 90288813) has the molecular formula C18H20ClN5O
and a molecular weight of 357.85 g/mol. Its IUPAC name is 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol |
| PubChem CID | 90288813 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol |
| SMILES | OCCN1CCC(n2cc(-c3cnc4ccc(Cl)nc4c3)cn2)CC1 |
| InChI | InChI=1S/C18H20ClN5O/c19-18-2-1-16-17(22-18)9-13(10-20-16)14-11-21-24(12-14)15-3-5-23(6-4-15)7-8-25/h1-2,9-12,15,25H,3-8H2 |
| InChIKey | JVWQZMIWSOQHSP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol?
The IUPAC name of 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol (CID 90288813) is 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol?
The canonical SMILES for 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol is OCCN1CCC(n2cc(-c3cnc4ccc(Cl)nc4c3)cn2)CC1.
What is the InChIKey of 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol?
The InChIKey is JVWQZMIWSOQHSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20ClN5O/c19-18-2-1-16-17(22-18)9-13(10-20-16)14-11-21-24(12-14)15-3-5-23(6-4-15)7-8-25/h1-2,9-12,15,25H,3-8H2.
What are the key properties of 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol?
2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol has a molecular weight of 357.85 g/mol, XLogP of 2.78, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]piperidin-1-yl]ethanol is sourced from PubChem (CID 90288813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).