C19H22N6O2 — CID 90288877
N-(3-hydroxypropyl)-6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridine-3-carboxamide (PubChem CID 90288877) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridine-3-carboxamide.
| Compound Name | N-(3-hydroxypropyl)-6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 90288877 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-(3-hydroxypropyl)-6-[(5-propan-2-ylpyridazin-3-yl)amino]-1,5-naphthyridine-3-carboxamide |
| SMILES | CC(C)c1cnnc(Nc2ccc3ncc(C(=O)NCCCO)cc3n2)c1 |
| InChI | InChI=1S/C19H22N6O2/c1-12(2)13-9-18(25-22-11-13)24-17-5-4-15-16(23-17)8-14(10-21-15)19(27)20-6-3-7-26/h4-5,8-12,26H,3,6-7H2,1-2H3,(H,20,27)(H,23,24,25) |
| InChIKey | GYMIKFWOLNVSHU-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|